C23H46N4O2Sn — CID 172615950
tert-butyl N-methyl-N-[1-(2-methyl-5-tributylstannyltriazol-4-yl)ethyl]carbamate (PubChem CID 172615950) has the molecular formula C23H46N4O2Sn and a molecular weight of 529.36 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[1-(2-methyl-5-tributylstannyltriazol-4-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[1-(2-methyl-5-tributylstannyltriazol-4-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 172615950 |
| Molecular Formula | C23H46N4O2Sn |
| Molecular Weight | 529.36 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | tert-butyl N-methyl-N-[1-(2-methyl-5-tributylstannyltriazol-4-yl)ethyl]carbamate |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1nn(C)nc1C(C)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H19N4O2.3C4H9.Sn/c1-8(9-7-12-15(6)13-9)14(5)10(16)17-11(2,3)4;3*1-3-4-2;/h8H,1-6H3;3*1,3-4H2,2H3; |
| InChIKey | WNAMMQZTSJYTBY-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.36 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |