C22H43N3O2Sn — CID 155641247
tert-butyl N-methyl-N-(1-methyl-5-tributylstannylpyrazol-3-yl)carbamate (PubChem CID 155641247) has the molecular formula C22H43N3O2Sn and a molecular weight of 500.32 g/mol. Its IUPAC name is tert-butyl N-methyl-N-(1-methyl-5-tributylstannylpyrazol-3-yl)carbamate.
| Compound Name | tert-butyl N-methyl-N-(1-methyl-5-tributylstannylpyrazol-3-yl)carbamate |
|---|---|
| PubChem CID | 155641247 |
| Molecular Formula | C22H43N3O2Sn |
| Molecular Weight | 500.32 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | tert-butyl N-methyl-N-(1-methyl-5-tributylstannylpyrazol-3-yl)carbamate |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cc(N(C)C(=O)OC(C)(C)C)nn1C |
| InChI | InChI=1S/C10H16N3O2.3C4H9.Sn/c1-10(2,3)15-9(14)13(5)8-6-7-12(4)11-8;3*1-3-4-2;/h6H,1-5H3;3*1,3-4H2,2H3; |
| InChIKey | KKGIFIPLHSKTLG-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.32 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |