C20H32O2 — CID 172616805
(6Z,8Z)-8,9,10-trimethyl-5-methylidene-4-(2-methylpropanoyl)dodeca-6,8-dienal (PubChem CID 172616805) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (6Z,8Z)-8,9,10-trimethyl-5-methylidene-4-(2-methylpropanoyl)dodeca-6,8-dienal.
| Compound Name | (6Z,8Z)-8,9,10-trimethyl-5-methylidene-4-(2-methylpropanoyl)dodeca-6,8-dienal |
|---|---|
| PubChem CID | 172616805 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (6Z,8Z)-8,9,10-trimethyl-5-methylidene-4-(2-methylpropanoyl)dodeca-6,8-dienal |
| SMILES | C=C(/C=C\C(C)=C(\C)C(C)CC)C(CCC=O)C(=O)C(C)C |
| InChI | InChI=1S/C20H32O2/c1-8-15(4)18(7)16(5)11-12-17(6)19(10-9-13-21)20(22)14(2)3/h11-15,19H,6,8-10H2,1-5,7H3/b12-11-,18-16- |
| InChIKey | JCTCLRUBEGSLOX-BHLQPLEVSA-N |
| XLogP | 5.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|