C10H18N2O2 — CID 167167888
N-[(3S)-2-(dimethylamino)-6-oxohex-1-en-3-yl]acetamide (PubChem CID 167167888) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is N-[(3S)-2-(dimethylamino)-6-oxohex-1-en-3-yl]acetamide.
| Compound Name | N-[(3S)-2-(dimethylamino)-6-oxohex-1-en-3-yl]acetamide |
|---|---|
| PubChem CID | 167167888 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | N-[(3S)-2-(dimethylamino)-6-oxohex-1-en-3-yl]acetamide |
| SMILES | C=C([C@H](CCC=O)NC(C)=O)N(C)C |
| InChI | InChI=1S/C10H18N2O2/c1-8(12(3)4)10(6-5-7-13)11-9(2)14/h7,10H,1,5-6H2,2-4H3,(H,11,14)/t10-/m0/s1 |
| InChIKey | QPHVSVNFAMIGCA-JTQLQIEISA-N |
| XLogP | 0.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|