C24H22FN3OS — CID 172627223
2-[(4-fluoro-2-pyridinyl)amino]-5-[(E)-hex-2-enyl]benzo[b][1,4]benzothiazepin-6-one (PubChem CID 172627223) has the molecular formula C24H22FN3OS and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-[(4-fluoro-2-pyridinyl)amino]-5-[(E)-hex-2-enyl]benzo[b][1,4]benzothiazepin-6-one.
| Compound Name | 2-[(4-fluoro-2-pyridinyl)amino]-5-[(E)-hex-2-enyl]benzo[b][1,4]benzothiazepin-6-one |
|---|---|
| PubChem CID | 172627223 |
| Molecular Formula | C24H22FN3OS |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 2-[(4-fluoro-2-pyridinyl)amino]-5-[(E)-hex-2-enyl]benzo[b][1,4]benzothiazepin-6-one |
| SMILES | CCC/C=C/CN1C(=O)c2ccccc2Sc2cc(Nc3cc(F)ccn3)ccc21 |
| InChI | InChI=1S/C24H22FN3OS/c1-2-3-4-7-14-28-20-11-10-18(27-23-15-17(25)12-13-26-23)16-22(20)30-21-9-6-5-8-19(21)24(28)29/h4-13,15-16H,2-3,14H2,1H3,(H,26,27)/b7-4+ |
| InChIKey | GBEWJNFXLFMIBJ-QPJJXVBHSA-N |
| XLogP | 6.43 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|