C21H14N6OS — CID 172627464
4-[(5-but-2-ynyl-6-oxobenzo[b][1,4]benzothiazepin-2-yl)amino]-1,3,5-triazine-2-carbonitrile (PubChem CID 172627464) has the molecular formula C21H14N6OS and a molecular weight of 398.45 g/mol. Its IUPAC name is 4-[(5-but-2-ynyl-6-oxobenzo[b][1,4]benzothiazepin-2-yl)amino]-1,3,5-triazine-2-carbonitrile.
| Compound Name | 4-[(5-but-2-ynyl-6-oxobenzo[b][1,4]benzothiazepin-2-yl)amino]-1,3,5-triazine-2-carbonitrile |
|---|---|
| PubChem CID | 172627464 |
| Molecular Formula | C21H14N6OS |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 4-[(5-but-2-ynyl-6-oxobenzo[b][1,4]benzothiazepin-2-yl)amino]-1,3,5-triazine-2-carbonitrile |
| SMILES | CC#CCN1C(=O)c2ccccc2Sc2cc(Nc3ncnc(C#N)n3)ccc21 |
| InChI | InChI=1S/C21H14N6OS/c1-2-3-10-27-16-9-8-14(25-21-24-13-23-19(12-22)26-21)11-18(16)29-17-7-5-4-6-15(17)20(27)28/h4-9,11,13H,10H2,1H3,(H,23,24,25,26) |
| InChIKey | BWNSWXHGMCMCMG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|