C21H16N4OS — CID 172627394
5-but-2-ynyl-2-(pyridazin-4-ylamino)benzo[b][1,4]benzothiazepin-6-one (PubChem CID 172627394) has the molecular formula C21H16N4OS and a molecular weight of 372.45 g/mol. Its IUPAC name is 5-but-2-ynyl-2-(pyridazin-4-ylamino)benzo[b][1,4]benzothiazepin-6-one.
| Compound Name | 5-but-2-ynyl-2-(pyridazin-4-ylamino)benzo[b][1,4]benzothiazepin-6-one |
|---|---|
| PubChem CID | 172627394 |
| Molecular Formula | C21H16N4OS |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 5-but-2-ynyl-2-(pyridazin-4-ylamino)benzo[b][1,4]benzothiazepin-6-one |
| SMILES | CC#CCN1C(=O)c2ccccc2Sc2cc(Nc3ccnnc3)ccc21 |
| InChI | InChI=1S/C21H16N4OS/c1-2-3-12-25-18-9-8-15(24-16-10-11-22-23-14-16)13-20(18)27-19-7-5-4-6-17(19)21(25)26/h4-11,13-14H,12H2,1H3,(H,22,24) |
| InChIKey | DMFOUTOOXDGINW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|