C23H23N3O3S — CID 172627355
N-(5-but-2-ynyl-6-oxopyrido[3,2-b][1,4]benzothiazepin-2-yl)-3-(methoxymethyl)cyclobutane-1-carboxamide (PubChem CID 172627355) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is N-(5-but-2-ynyl-6-oxopyrido[3,2-b][1,4]benzothiazepin-2-yl)-3-(methoxymethyl)cyclobutane-1-carboxamide.
| Compound Name | N-(5-but-2-ynyl-6-oxopyrido[3,2-b][1,4]benzothiazepin-2-yl)-3-(methoxymethyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 172627355 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-(5-but-2-ynyl-6-oxopyrido[3,2-b][1,4]benzothiazepin-2-yl)-3-(methoxymethyl)cyclobutane-1-carboxamide |
| SMILES | CC#CCN1C(=O)c2ccccc2Sc2cc(NC(=O)C3CC(COC)C3)cnc21 |
| InChI | InChI=1S/C23H23N3O3S/c1-3-4-9-26-21-20(30-19-8-6-5-7-18(19)23(26)28)12-17(13-24-21)25-22(27)16-10-15(11-16)14-29-2/h5-8,12-13,15-16H,9-11,14H2,1-2H3,(H,25,27) |
| InChIKey | PRVHIZJBUPRLIM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|