C22H22N2O2S — CID 172627444
5-but-2-ynyl-2-[(3-methoxycyclobutyl)amino]benzo[b][1,4]benzothiazepin-6-one (PubChem CID 172627444) has the molecular formula C22H22N2O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is 5-but-2-ynyl-2-[(3-methoxycyclobutyl)amino]benzo[b][1,4]benzothiazepin-6-one.
| Compound Name | 5-but-2-ynyl-2-[(3-methoxycyclobutyl)amino]benzo[b][1,4]benzothiazepin-6-one |
|---|---|
| PubChem CID | 172627444 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 5-but-2-ynyl-2-[(3-methoxycyclobutyl)amino]benzo[b][1,4]benzothiazepin-6-one |
| SMILES | CC#CCN1C(=O)c2ccccc2Sc2cc(NC3CC(OC)C3)ccc21 |
| InChI | InChI=1S/C22H22N2O2S/c1-3-4-11-24-19-10-9-15(23-16-12-17(13-16)26-2)14-21(19)27-20-8-6-5-7-18(20)22(24)25/h5-10,14,16-17,23H,11-13H2,1-2H3 |
| InChIKey | GGKCZMFYNJZVIL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|