C26H27N3OS — CID 172627396
2-[(3,5-dimethyl-2-pyridinyl)amino]-5-[(E)-hex-2-enyl]benzo[b][1,4]benzothiazepin-6-one (PubChem CID 172627396) has the molecular formula C26H27N3OS and a molecular weight of 429.59 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-2-pyridinyl)amino]-5-[(E)-hex-2-enyl]benzo[b][1,4]benzothiazepin-6-one.
| Compound Name | 2-[(3,5-dimethyl-2-pyridinyl)amino]-5-[(E)-hex-2-enyl]benzo[b][1,4]benzothiazepin-6-one |
|---|---|
| PubChem CID | 172627396 |
| Molecular Formula | C26H27N3OS |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 2-[(3,5-dimethyl-2-pyridinyl)amino]-5-[(E)-hex-2-enyl]benzo[b][1,4]benzothiazepin-6-one |
| SMILES | CCC/C=C/CN1C(=O)c2ccccc2Sc2cc(Nc3ncc(C)cc3C)ccc21 |
| InChI | InChI=1S/C26H27N3OS/c1-4-5-6-9-14-29-22-13-12-20(28-25-19(3)15-18(2)17-27-25)16-24(22)31-23-11-8-7-10-21(23)26(29)30/h6-13,15-17H,4-5,14H2,1-3H3,(H,27,28)/b9-6+ |
| InChIKey | JIVVCSCWXKTVMS-RMKNXTFCSA-N |
| XLogP | 6.91 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|