C23H22N4OS — CID 172627259
5-[(E)-hex-2-enyl]-2-(pyrazin-2-ylamino)benzo[b][1,4]benzothiazepin-6-one (PubChem CID 172627259) has the molecular formula C23H22N4OS and a molecular weight of 402.52 g/mol. Its IUPAC name is 5-[(E)-hex-2-enyl]-2-(pyrazin-2-ylamino)benzo[b][1,4]benzothiazepin-6-one.
| Compound Name | 5-[(E)-hex-2-enyl]-2-(pyrazin-2-ylamino)benzo[b][1,4]benzothiazepin-6-one |
|---|---|
| PubChem CID | 172627259 |
| Molecular Formula | C23H22N4OS |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 5-[(E)-hex-2-enyl]-2-(pyrazin-2-ylamino)benzo[b][1,4]benzothiazepin-6-one |
| SMILES | CCC/C=C/CN1C(=O)c2ccccc2Sc2cc(Nc3cnccn3)ccc21 |
| InChI | InChI=1S/C23H22N4OS/c1-2-3-4-7-14-27-19-11-10-17(26-22-16-24-12-13-25-22)15-21(19)29-20-9-6-5-8-18(20)23(27)28/h4-13,15-16H,2-3,14H2,1H3,(H,25,26)/b7-4+ |
| InChIKey | HERHGTDUQXJLAA-QPJJXVBHSA-N |
| XLogP | 5.69 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|