C20H16N2O5S — CID 172643655
4-[2-hydroxy-3-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]propoxy]chromen-2-one (PubChem CID 172643655) has the molecular formula C20H16N2O5S and a molecular weight of 396.42 g/mol. Its IUPAC name is 4-[2-hydroxy-3-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]propoxy]chromen-2-one.
| Compound Name | 4-[2-hydroxy-3-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]propoxy]chromen-2-one |
|---|---|
| PubChem CID | 172643655 |
| Molecular Formula | C20H16N2O5S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 4-[2-hydroxy-3-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]propoxy]chromen-2-one |
| SMILES | O=c1cc(OCC(O)CSc2nnc(-c3ccccc3)o2)c2ccccc2o1 |
| InChI | InChI=1S/C20H16N2O5S/c23-14(11-25-17-10-18(24)26-16-9-5-4-8-15(16)17)12-28-20-22-21-19(27-20)13-6-2-1-3-7-13/h1-10,14,23H,11-12H2 |
| InChIKey | ZJYNSGMWFJBRPF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 98.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|