C28H23BrN4O5S — CID 176910423
4-[3-[[4-[(E)-(4-bromophenyl)methylideneamino]-5-(phenoxymethyl)-1,2,4-triazol-3-yl]sulfanyl]-2-hydroxypropoxy]chromen-2-one (PubChem CID 176910423) has the molecular formula C28H23BrN4O5S and a molecular weight of 607.49 g/mol. Its IUPAC name is 4-[3-[[4-[(E)-(4-bromophenyl)methylideneamino]-5-(phenoxymethyl)-1,2,4-triazol-3-yl]sulfanyl]-2-hydroxypropoxy]chromen-2-one.
| Compound Name | 4-[3-[[4-[(E)-(4-bromophenyl)methylideneamino]-5-(phenoxymethyl)-1,2,4-triazol-3-yl]sulfanyl]-2-hydroxypropoxy]chromen-2-one |
|---|---|
| PubChem CID | 176910423 |
| Molecular Formula | C28H23BrN4O5S |
| Molecular Weight | 607.49 g/mol |
| Exact Mass | 606.06 |
| IUPAC Name | 4-[3-[[4-[(E)-(4-bromophenyl)methylideneamino]-5-(phenoxymethyl)-1,2,4-triazol-3-yl]sulfanyl]-2-hydroxypropoxy]chromen-2-one |
| SMILES | O=c1cc(OCC(O)CSc2nnc(COc3ccccc3)n2/N=C/c2ccc(Br)cc2)c2ccccc2o1 |
| InChI | InChI=1S/C28H23BrN4O5S/c29-20-12-10-19(11-13-20)15-30-33-26(17-36-22-6-2-1-3-7-22)31-32-28(33)39-18-21(34)16-37-25-14-27(35)38-24-9-5-4-8-23(24)25/h1-15,21,34H,16-18H2/b30-15+ |
| InChIKey | MDKFXWYYAWAZNT-FJEPWZHXSA-N |
| XLogP | 5.14 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|