C30H28N4O6S — CID 176910413
4-[2-hydroxy-3-[[4-[(E)-(4-hydroxy-3,5-dimethylphenyl)methylideneamino]-5-(phenoxymethyl)-1,2,4-triazol-3-yl]sulfanyl]propoxy]chromen-2-one (PubChem CID 176910413) has the molecular formula C30H28N4O6S and a molecular weight of 572.64 g/mol. Its IUPAC name is 4-[2-hydroxy-3-[[4-[(E)-(4-hydroxy-3,5-dimethylphenyl)methylideneamino]-5-(phenoxymethyl)-1,2,4-triazol-3-yl]sulfanyl]propoxy]chromen-2-one.
| Compound Name | 4-[2-hydroxy-3-[[4-[(E)-(4-hydroxy-3,5-dimethylphenyl)methylideneamino]-5-(phenoxymethyl)-1,2,4-triazol-3-yl]sulfanyl]propoxy]chromen-2-one |
|---|---|
| PubChem CID | 176910413 |
| Molecular Formula | C30H28N4O6S |
| Molecular Weight | 572.64 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | 4-[2-hydroxy-3-[[4-[(E)-(4-hydroxy-3,5-dimethylphenyl)methylideneamino]-5-(phenoxymethyl)-1,2,4-triazol-3-yl]sulfanyl]propoxy]chromen-2-one |
| SMILES | Cc1cc(/C=N/n2c(COc3ccccc3)nnc2SCC(O)COc2cc(=O)oc3ccccc23)cc(C)c1O |
| InChI | InChI=1S/C30H28N4O6S/c1-19-12-21(13-20(2)29(19)37)15-31-34-27(17-38-23-8-4-3-5-9-23)32-33-30(34)41-18-22(35)16-39-26-14-28(36)40-25-11-7-6-10-24(25)26/h3-15,22,35,37H,16-18H2,1-2H3/b31-15+ |
| InChIKey | SRXJOGWUPHORIB-IBBHUPRXSA-N |
| XLogP | 4.70 |
| TPSA | 132.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.64 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|