C15H20BN3O3 — CID 172644225
3-(3-methylpyrazol-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyridin-2-one (PubChem CID 172644225) has the molecular formula C15H20BN3O3 and a molecular weight of 301.16 g/mol. Its IUPAC name is 3-(3-methylpyrazol-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyridin-2-one.
| Compound Name | 3-(3-methylpyrazol-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 172644225 |
| Molecular Formula | C15H20BN3O3 |
| Molecular Weight | 301.16 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 3-(3-methylpyrazol-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyridin-2-one |
| SMILES | Cc1ccn(-c2cc(B3OC(C)(C)C(C)(C)O3)c[nH]c2=O)n1 |
| InChI | InChI=1S/C15H20BN3O3/c1-10-6-7-19(18-10)12-8-11(9-17-13(12)20)16-21-14(2,3)15(4,5)22-16/h6-9H,1-5H3,(H,17,20) |
| InChIKey | MDGCMXQOSMVODC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.16 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|