C20H16Br2NO4P — CID 172652576
2,2-dibromo-1-[3-(diphenoxyphosphorylamino)phenyl]ethanone (PubChem CID 172652576) has the molecular formula C20H16Br2NO4P and a molecular weight of 525.13 g/mol. Its IUPAC name is 2,2-dibromo-1-[3-(diphenoxyphosphorylamino)phenyl]ethanone.
| Compound Name | 2,2-dibromo-1-[3-(diphenoxyphosphorylamino)phenyl]ethanone |
|---|---|
| PubChem CID | 172652576 |
| Molecular Formula | C20H16Br2NO4P |
| Molecular Weight | 525.13 g/mol |
| Exact Mass | 522.92 |
| IUPAC Name | 2,2-dibromo-1-[3-(diphenoxyphosphorylamino)phenyl]ethanone |
| SMILES | O=C(c1cccc(NP(=O)(Oc2ccccc2)Oc2ccccc2)c1)C(Br)Br |
| InChI | InChI=1S/C20H16Br2NO4P/c21-20(22)19(24)15-8-7-9-16(14-15)23-28(25,26-17-10-3-1-4-11-17)27-18-12-5-2-6-13-18/h1-14,20H,(H,23,25) |
| InChIKey | IKZNRFMLJHWLAS-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.13 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|