C18H28N4O2 — CID 172657705
N-[(3aR,5S,6S,7aS)-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-5-cyclohexyl-1H-pyrazole-4-carboxamide (PubChem CID 172657705) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is N-[(3aR,5S,6S,7aS)-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-5-cyclohexyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-[(3aR,5S,6S,7aS)-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-5-cyclohexyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 172657705 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | N-[(3aR,5S,6S,7aS)-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-5-cyclohexyl-1H-pyrazole-4-carboxamide |
| SMILES | O=C(N[C@H]1C[C@H]2CNC[C@H]2C[C@@H]1O)c1cn[nH]c1C1CCCCC1 |
| InChI | InChI=1S/C18H28N4O2/c23-16-7-13-9-19-8-12(13)6-15(16)21-18(24)14-10-20-22-17(14)11-4-2-1-3-5-11/h10-13,15-16,19,23H,1-9H2,(H,20,22)(H,21,24)/t12-,13+,15-,16-/m0/s1 |
| InChIKey | UVNKUIFKLMWVCO-XRGAULLZSA-N |
| XLogP | 1.55 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |