C33H41N5O5 — CID 172659168
12-(5-cyclohexyl-1H-pyrazole-4-carbonyl)-23-hydroxy-5-methoxy-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2(25),3,5,20(24),21-hexaene-7,16-dione (PubChem CID 172659168) has the molecular formula C33H41N5O5 and a molecular weight of 587.72 g/mol. Its IUPAC name is 12-(5-cyclohexyl-1H-pyrazole-4-carbonyl)-23-hydroxy-5-methoxy-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2(25),3,5,20(24),21-hexaene-7,16-dione.
| Compound Name | 12-(5-cyclohexyl-1H-pyrazole-4-carbonyl)-23-hydroxy-5-methoxy-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2(25),3,5,20(24),21-hexaene-7,16-dione |
|---|---|
| PubChem CID | 172659168 |
| Molecular Formula | C33H41N5O5 |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.31 |
| IUPAC Name | 12-(5-cyclohexyl-1H-pyrazole-4-carbonyl)-23-hydroxy-5-methoxy-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2(25),3,5,20(24),21-hexaene-7,16-dione |
| SMILES | COc1ccc2cc1C(=O)NCCCN(C(=O)c1cn[nH]c1C1CCCCC1)CCCC(=O)NCCc1ccc(O)c-2c1 |
| InChI | InChI=1S/C33H41N5O5/c1-43-29-13-11-24-20-26(29)32(41)35-15-6-18-38(33(42)27-21-36-37-31(27)23-7-3-2-4-8-23)17-5-9-30(40)34-16-14-22-10-12-28(39)25(24)19-22/h10-13,19-21,23,39H,2-9,14-18H2,1H3,(H,34,40)(H,35,41)(H,36,37) |
| InChIKey | IRCVYDQSCXMJMB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 136.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |