C28H32N4O6 — CID 172673626
23-hydroxy-5-methoxy-12-(4-methyl-1,3-oxazole-5-carbonyl)-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2(25),3,5,20(24),21-hexaene-7,16-dione (PubChem CID 172673626) has the molecular formula C28H32N4O6 and a molecular weight of 520.59 g/mol. Its IUPAC name is 23-hydroxy-5-methoxy-12-(4-methyl-1,3-oxazole-5-carbonyl)-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2(25),3,5,20(24),21-hexaene-7,16-dione.
| Compound Name | 23-hydroxy-5-methoxy-12-(4-methyl-1,3-oxazole-5-carbonyl)-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2(25),3,5,20(24),21-hexaene-7,16-dione |
|---|---|
| PubChem CID | 172673626 |
| Molecular Formula | C28H32N4O6 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 23-hydroxy-5-methoxy-12-(4-methyl-1,3-oxazole-5-carbonyl)-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2(25),3,5,20(24),21-hexaene-7,16-dione |
| SMILES | COc1ccc2cc1C(=O)NCCCN(C(=O)c1ocnc1C)CCCC(=O)NCCc1ccc(O)c-2c1 |
| InChI | InChI=1S/C28H32N4O6/c1-18-26(38-17-31-18)28(36)32-13-3-5-25(34)29-12-10-19-6-8-23(33)21(15-19)20-7-9-24(37-2)22(16-20)27(35)30-11-4-14-32/h6-9,15-17,33H,3-5,10-14H2,1-2H3,(H,29,34)(H,30,35) |
| InChIKey | WGUFDEWSWACHCP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 134.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |