C29H31FN4O5 — CID 172661572
3-fluoro-23-hydroxy-12-(6-methoxypyridine-3-carbonyl)-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2,4,6(25),20(24),21-hexaene-7,16-dione (PubChem CID 172661572) has the molecular formula C29H31FN4O5 and a molecular weight of 534.59 g/mol. Its IUPAC name is 3-fluoro-23-hydroxy-12-(6-methoxypyridine-3-carbonyl)-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2,4,6(25),20(24),21-hexaene-7,16-dione.
| Compound Name | 3-fluoro-23-hydroxy-12-(6-methoxypyridine-3-carbonyl)-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2,4,6(25),20(24),21-hexaene-7,16-dione |
|---|---|
| PubChem CID | 172661572 |
| Molecular Formula | C29H31FN4O5 |
| Molecular Weight | 534.59 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | 3-fluoro-23-hydroxy-12-(6-methoxypyridine-3-carbonyl)-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2,4,6(25),20(24),21-hexaene-7,16-dione |
| SMILES | COc1ccc(C(=O)N2CCCNC(=O)c3ccc(F)c(c3)-c3cc(ccc3O)CCNC(=O)CCC2)cn1 |
| InChI | InChI=1S/C29H31FN4O5/c1-39-27-10-7-21(18-33-27)29(38)34-14-2-4-26(36)31-13-11-19-5-9-25(35)23(16-19)22-17-20(6-8-24(22)30)28(37)32-12-3-15-34/h5-10,16-18,35H,2-4,11-15H2,1H3,(H,31,36)(H,32,37) |
| InChIKey | NGIYOHFKTBILNM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |