C32H33N5O5S — CID 172663877
23-hydroxy-12-[5-(pyrimidin-2-ylsulfanylmethyl)furan-2-carbonyl]-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2(25),3,5,20(24),21-hexaene-7,16-dione (PubChem CID 172663877) has the molecular formula C32H33N5O5S and a molecular weight of 599.71 g/mol. Its IUPAC name is 23-hydroxy-12-[5-(pyrimidin-2-ylsulfanylmethyl)furan-2-carbonyl]-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2(25),3,5,20(24),21-hexaene-7,16-dione.
| Compound Name | 23-hydroxy-12-[5-(pyrimidin-2-ylsulfanylmethyl)furan-2-carbonyl]-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2(25),3,5,20(24),21-hexaene-7,16-dione |
|---|---|
| PubChem CID | 172663877 |
| Molecular Formula | C32H33N5O5S |
| Molecular Weight | 599.71 g/mol |
| Exact Mass | 599.22 |
| IUPAC Name | 23-hydroxy-12-[5-(pyrimidin-2-ylsulfanylmethyl)furan-2-carbonyl]-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2(25),3,5,20(24),21-hexaene-7,16-dione |
| SMILES | O=C1CCCN(C(=O)c2ccc(CSc3ncccn3)o2)CCCNC(=O)c2cccc(c2)-c2cc(ccc2O)CCN1 |
| InChI | InChI=1S/C32H33N5O5S/c38-27-10-8-22-12-16-33-29(39)7-2-17-37(18-4-15-34-30(40)24-6-1-5-23(20-24)26(27)19-22)31(41)28-11-9-25(42-28)21-43-32-35-13-3-14-36-32/h1,3,5-6,8-11,13-14,19-20,38H,2,4,7,12,15-18,21H2,(H,33,39)(H,34,40) |
| InChIKey | HPUPIILIORUIHU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 137.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.71 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |