C32H37N3O5 — CID 172663912
22-hydroxy-13-[2-(2,3,6-trimethylphenoxy)acetyl]-8,13,16-triazatricyclo[17.3.1.12,6]tetracosa-1(22),2(24),3,5,19(23),20-hexaene-7,15-dione (PubChem CID 172663912) has the molecular formula C32H37N3O5 and a molecular weight of 543.66 g/mol. Its IUPAC name is 22-hydroxy-13-[2-(2,3,6-trimethylphenoxy)acetyl]-8,13,16-triazatricyclo[17.3.1.12,6]tetracosa-1(22),2(24),3,5,19(23),20-hexaene-7,15-dione.
| Compound Name | 22-hydroxy-13-[2-(2,3,6-trimethylphenoxy)acetyl]-8,13,16-triazatricyclo[17.3.1.12,6]tetracosa-1(22),2(24),3,5,19(23),20-hexaene-7,15-dione |
|---|---|
| PubChem CID | 172663912 |
| Molecular Formula | C32H37N3O5 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | 22-hydroxy-13-[2-(2,3,6-trimethylphenoxy)acetyl]-8,13,16-triazatricyclo[17.3.1.12,6]tetracosa-1(22),2(24),3,5,19(23),20-hexaene-7,15-dione |
| SMILES | Cc1ccc(C)c(OCC(=O)N2CCCCNC(=O)c3cccc(c3)-c3cc(ccc3O)CCNC(=O)C2)c1C |
| InChI | InChI=1S/C32H37N3O5/c1-21-9-10-22(2)31(23(21)3)40-20-30(38)35-16-5-4-14-34-32(39)26-8-6-7-25(18-26)27-17-24(11-12-28(27)36)13-15-33-29(37)19-35/h6-12,17-18,36H,4-5,13-16,19-20H2,1-3H3,(H,33,37)(H,34,39) |
| InChIKey | NNMMOVJIQGAWOI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |