C30H31N5O5S — CID 172661610
23-hydroxy-12-[2-(4-oxothieno[3,2-d]pyrimidin-3-yl)acetyl]-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2(25),3,5,20(24),21-hexaene-7,16-dione (PubChem CID 172661610) has the molecular formula C30H31N5O5S and a molecular weight of 573.68 g/mol. Its IUPAC name is 23-hydroxy-12-[2-(4-oxothieno[3,2-d]pyrimidin-3-yl)acetyl]-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2(25),3,5,20(24),21-hexaene-7,16-dione.
| Compound Name | 23-hydroxy-12-[2-(4-oxothieno[3,2-d]pyrimidin-3-yl)acetyl]-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2(25),3,5,20(24),21-hexaene-7,16-dione |
|---|---|
| PubChem CID | 172661610 |
| Molecular Formula | C30H31N5O5S |
| Molecular Weight | 573.68 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | 23-hydroxy-12-[2-(4-oxothieno[3,2-d]pyrimidin-3-yl)acetyl]-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2(25),3,5,20(24),21-hexaene-7,16-dione |
| SMILES | O=C1CCCN(C(=O)Cn2cnc3ccsc3c2=O)CCCNC(=O)c2cccc(c2)-c2cc(ccc2O)CCN1 |
| InChI | InChI=1S/C30H31N5O5S/c36-25-8-7-20-9-12-31-26(37)6-2-13-34(27(38)18-35-19-33-24-10-15-41-28(24)30(35)40)14-3-11-32-29(39)22-5-1-4-21(17-22)23(25)16-20/h1,4-5,7-8,10,15-17,19,36H,2-3,6,9,11-14,18H2,(H,31,37)(H,32,39) |
| InChIKey | JTVNTNXCQNEKEU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.68 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |