C29H33N5O4 — CID 172666391
23-hydroxy-12-(3-pyrazin-2-ylpropanoyl)-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2(25),3,5,20(24),21-hexaene-7,16-dione (PubChem CID 172666391) has the molecular formula C29H33N5O4 and a molecular weight of 515.61 g/mol. Its IUPAC name is 23-hydroxy-12-(3-pyrazin-2-ylpropanoyl)-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2(25),3,5,20(24),21-hexaene-7,16-dione.
| Compound Name | 23-hydroxy-12-(3-pyrazin-2-ylpropanoyl)-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2(25),3,5,20(24),21-hexaene-7,16-dione |
|---|---|
| PubChem CID | 172666391 |
| Molecular Formula | C29H33N5O4 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | 23-hydroxy-12-(3-pyrazin-2-ylpropanoyl)-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2(25),3,5,20(24),21-hexaene-7,16-dione |
| SMILES | O=C1CCCN(C(=O)CCc2cnccn2)CCCNC(=O)c2cccc(c2)-c2cc(ccc2O)CCN1 |
| InChI | InChI=1S/C29H33N5O4/c35-26-9-7-21-11-13-32-27(36)6-2-16-34(28(37)10-8-24-20-30-14-15-31-24)17-3-12-33-29(38)23-5-1-4-22(19-23)25(26)18-21/h1,4-5,7,9,14-15,18-20,35H,2-3,6,8,10-13,16-17H2,(H,32,36)(H,33,38) |
| InChIKey | DUGNRBXRZKLIRQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |