C27H30N4O4S — CID 172666326
22-hydroxy-13-[2-(2-methyl-1,3-thiazol-4-yl)acetyl]-8,13,16-triazatricyclo[17.3.1.12,6]tetracosa-1(22),2(24),3,5,19(23),20-hexaene-7,15-dione (PubChem CID 172666326) has the molecular formula C27H30N4O4S and a molecular weight of 506.63 g/mol. Its IUPAC name is 22-hydroxy-13-[2-(2-methyl-1,3-thiazol-4-yl)acetyl]-8,13,16-triazatricyclo[17.3.1.12,6]tetracosa-1(22),2(24),3,5,19(23),20-hexaene-7,15-dione.
| Compound Name | 22-hydroxy-13-[2-(2-methyl-1,3-thiazol-4-yl)acetyl]-8,13,16-triazatricyclo[17.3.1.12,6]tetracosa-1(22),2(24),3,5,19(23),20-hexaene-7,15-dione |
|---|---|
| PubChem CID | 172666326 |
| Molecular Formula | C27H30N4O4S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 22-hydroxy-13-[2-(2-methyl-1,3-thiazol-4-yl)acetyl]-8,13,16-triazatricyclo[17.3.1.12,6]tetracosa-1(22),2(24),3,5,19(23),20-hexaene-7,15-dione |
| SMILES | Cc1nc(CC(=O)N2CCCCNC(=O)c3cccc(c3)-c3cc(ccc3O)CCNC(=O)C2)cs1 |
| InChI | InChI=1S/C27H30N4O4S/c1-18-30-22(17-36-18)15-26(34)31-12-3-2-10-29-27(35)21-6-4-5-20(14-21)23-13-19(7-8-24(23)32)9-11-28-25(33)16-31/h4-8,13-14,17,32H,2-3,9-12,15-16H2,1H3,(H,28,33)(H,29,35) |
| InChIKey | YUQJJBBTWDVRSG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |