C34H40N4O4 — CID 172673611
23-hydroxy-12-(4-piperidin-1-ylbenzoyl)-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2(25),3,5,20(24),21-hexaene-7,16-dione (PubChem CID 172673611) has the molecular formula C34H40N4O4 and a molecular weight of 568.72 g/mol. Its IUPAC name is 23-hydroxy-12-(4-piperidin-1-ylbenzoyl)-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2(25),3,5,20(24),21-hexaene-7,16-dione.
| Compound Name | 23-hydroxy-12-(4-piperidin-1-ylbenzoyl)-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2(25),3,5,20(24),21-hexaene-7,16-dione |
|---|---|
| PubChem CID | 172673611 |
| Molecular Formula | C34H40N4O4 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | 23-hydroxy-12-(4-piperidin-1-ylbenzoyl)-8,12,17-triazatricyclo[18.3.1.12,6]pentacosa-1(23),2(25),3,5,20(24),21-hexaene-7,16-dione |
| SMILES | O=C1CCCN(C(=O)c2ccc(N3CCCCC3)cc2)CCCNC(=O)c2cccc(c2)-c2cc(ccc2O)CCN1 |
| InChI | InChI=1S/C34H40N4O4/c39-31-15-10-25-16-18-35-32(40)9-5-21-38(34(42)26-11-13-29(14-12-26)37-19-2-1-3-20-37)22-6-17-36-33(41)28-8-4-7-27(24-28)30(31)23-25/h4,7-8,10-15,23-24,39H,1-3,5-6,9,16-22H2,(H,35,40)(H,36,41) |
| InChIKey | GWLPVMLYYHKVJT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |