C24H32N2O2 — CID 172664952
(3aR,5R,6R,7aS)-2-[(4-methylnaphthalen-1-yl)methyl]-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 172664952) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-2-[(4-methylnaphthalen-1-yl)methyl]-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-2-[(4-methylnaphthalen-1-yl)methyl]-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 172664952 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | (3aR,5R,6R,7aS)-2-[(4-methylnaphthalen-1-yl)methyl]-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | Cc1ccc(CN2C[C@H]3C[C@@H](N4CCOCC4)[C@H](O)C[C@H]3C2)c2ccccc12 |
| InChI | InChI=1S/C24H32N2O2/c1-17-6-7-18(22-5-3-2-4-21(17)22)14-25-15-19-12-23(24(27)13-20(19)16-25)26-8-10-28-11-9-26/h2-7,19-20,23-24,27H,8-16H2,1H3/t19-,20+,23-,24-/m1/s1 |
| InChIKey | MMNRKPZCLIWPMD-WNXIRNOKSA-N |
| XLogP | 3.05 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |