C18H30N4O2 — CID 172667339
(3aR,5R,6R,7aS)-2-[(2,5-dimethylpyrazol-3-yl)methyl]-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 172667339) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-2-[(2,5-dimethylpyrazol-3-yl)methyl]-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-2-[(2,5-dimethylpyrazol-3-yl)methyl]-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 172667339 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | (3aR,5R,6R,7aS)-2-[(2,5-dimethylpyrazol-3-yl)methyl]-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | Cc1cc(CN2C[C@H]3C[C@@H](N4CCOCC4)[C@H](O)C[C@H]3C2)n(C)n1 |
| InChI | InChI=1S/C18H30N4O2/c1-13-7-16(20(2)19-13)12-21-10-14-8-17(18(23)9-15(14)11-21)22-3-5-24-6-4-22/h7,14-15,17-18,23H,3-6,8-12H2,1-2H3/t14-,15+,17-,18-/m1/s1 |
| InChIKey | VVPGDJDTBYXJOK-CYGHRXIMSA-N |
| XLogP | 0.63 |
| TPSA | 53.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |