C22H30N2O4 — CID 172666012
N-[(3aR,5S,6S,7aS)-2-(cyclobutanecarbonyl)-6-(cyclopropylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]furan-2-carboxamide (PubChem CID 172666012) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is N-[(3aR,5S,6S,7aS)-2-(cyclobutanecarbonyl)-6-(cyclopropylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]furan-2-carboxamide.
| Compound Name | N-[(3aR,5S,6S,7aS)-2-(cyclobutanecarbonyl)-6-(cyclopropylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 172666012 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | N-[(3aR,5S,6S,7aS)-2-(cyclobutanecarbonyl)-6-(cyclopropylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]furan-2-carboxamide |
| SMILES | O=C(N[C@H]1C[C@H]2CN(C(=O)C3CCC3)C[C@H]2C[C@@H]1OCC1CC1)c1ccco1 |
| InChI | InChI=1S/C22H30N2O4/c25-21(19-5-2-8-27-19)23-18-9-16-11-24(22(26)15-3-1-4-15)12-17(16)10-20(18)28-13-14-6-7-14/h2,5,8,14-18,20H,1,3-4,6-7,9-13H2,(H,23,25)/t16-,17+,18-,20-/m0/s1 |
| InChIKey | KWPJCODAZHNJNU-DMUMMCEESA-N |
| XLogP | 2.84 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |