C20H32N4O3S — CID 172669564
2-[(3aS,5R,6R,7aR)-5-acetamido-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-N-(4-tert-butyl-1,3-thiazol-2-yl)acetamide (PubChem CID 172669564) has the molecular formula C20H32N4O3S and a molecular weight of 408.57 g/mol. Its IUPAC name is 2-[(3aS,5R,6R,7aR)-5-acetamido-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-N-(4-tert-butyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[(3aS,5R,6R,7aR)-5-acetamido-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-N-(4-tert-butyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 172669564 |
| Molecular Formula | C20H32N4O3S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 2-[(3aS,5R,6R,7aR)-5-acetamido-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-N-(4-tert-butyl-1,3-thiazol-2-yl)acetamide |
| SMILES | CO[C@@H]1C[C@H]2CN(CC(=O)Nc3nc(C(C)(C)C)cs3)C[C@H]2C[C@H]1NC(C)=O |
| InChI | InChI=1S/C20H32N4O3S/c1-12(25)21-15-6-13-8-24(9-14(13)7-16(15)27-5)10-18(26)23-19-22-17(11-28-19)20(2,3)4/h11,13-16H,6-10H2,1-5H3,(H,21,25)(H,22,23,26)/t13-,14+,15-,16-/m1/s1 |
| InChIKey | KVOWKUXNBZPJMJ-QKPAOTATSA-N |
| XLogP | 2.24 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |