C21H26ClN5O2 — CID 172671867
[(3aR,5R,6R,7aS)-5-hydroxy-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-chloro-4-pyrrolidin-1-ylphenyl)methanone (PubChem CID 172671867) has the molecular formula C21H26ClN5O2 and a molecular weight of 415.93 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-hydroxy-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-chloro-4-pyrrolidin-1-ylphenyl)methanone.
| Compound Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-chloro-4-pyrrolidin-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 172671867 |
| Molecular Formula | C21H26ClN5O2 |
| Molecular Weight | 415.93 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-chloro-4-pyrrolidin-1-ylphenyl)methanone |
| SMILES | O=C(c1ccc(N2CCCC2)c(Cl)c1)N1C[C@H]2C[C@@H](n3cncn3)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C21H26ClN5O2/c22-17-7-14(3-4-18(17)25-5-1-2-6-25)21(29)26-10-15-8-19(27-13-23-12-24-27)20(28)9-16(15)11-26/h3-4,7,12-13,15-16,19-20,28H,1-2,5-6,8-11H2/t15-,16+,19-,20-/m1/s1 |
| InChIKey | NOEYQKPJKXQJIT-WOUAJJJCSA-N |
| XLogP | 2.62 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.93 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |