C17H19IN6O2 — CID 172676966
(1R,2S,4R,5S)-4-[6-(cyclopentylamino)-2-iodopurin-9-yl]-2,3-dihydroxybicyclo[3.1.0]hexane-1-carbonitrile (PubChem CID 172676966) has the molecular formula C17H19IN6O2 and a molecular weight of 466.28 g/mol. Its IUPAC name is (1R,2S,4R,5S)-4-[6-(cyclopentylamino)-2-iodopurin-9-yl]-2,3-dihydroxybicyclo[3.1.0]hexane-1-carbonitrile.
| Compound Name | (1R,2S,4R,5S)-4-[6-(cyclopentylamino)-2-iodopurin-9-yl]-2,3-dihydroxybicyclo[3.1.0]hexane-1-carbonitrile |
|---|---|
| PubChem CID | 172676966 |
| Molecular Formula | C17H19IN6O2 |
| Molecular Weight | 466.28 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | (1R,2S,4R,5S)-4-[6-(cyclopentylamino)-2-iodopurin-9-yl]-2,3-dihydroxybicyclo[3.1.0]hexane-1-carbonitrile |
| SMILES | N#C[C@@]12C[C@@H]1[C@@H](n1cnc3c(NC4CCCC4)nc(I)nc31)C(O)[C@H]2O |
| InChI | InChI=1S/C17H19IN6O2/c18-16-22-14(21-8-3-1-2-4-8)10-15(23-16)24(7-20-10)11-9-5-17(9,6-19)13(26)12(11)25/h7-9,11-13,25-26H,1-5H2,(H,21,22,23)/t9-,11-,12?,13-,17+/m1/s1 |
| InChIKey | KEPFBOIGUREUTB-VIWDHNDASA-N |
| XLogP | 1.59 |
| TPSA | 119.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|