C16H13BrN2O3S2 — CID 17268074
propan-2-yl 2-[[(E)-3-(5-bromothiophen-2-yl)-2-cyanoprop-2-enoyl]amino]thiophene-3-carboxylate (PubChem CID 17268074) has the molecular formula C16H13BrN2O3S2 and a molecular weight of 425.33 g/mol. Its IUPAC name is propan-2-yl 2-[[(E)-3-(5-bromothiophen-2-yl)-2-cyanoprop-2-enoyl]amino]thiophene-3-carboxylate.
| Compound Name | propan-2-yl 2-[[(E)-3-(5-bromothiophen-2-yl)-2-cyanoprop-2-enoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17268074 |
| Molecular Formula | C16H13BrN2O3S2 |
| Molecular Weight | 425.33 g/mol |
| Exact Mass | 423.96 |
| IUPAC Name | propan-2-yl 2-[[(E)-3-(5-bromothiophen-2-yl)-2-cyanoprop-2-enoyl]amino]thiophene-3-carboxylate |
| SMILES | CC(C)OC(=O)c1ccsc1NC(=O)/C(C#N)=C/c1ccc(Br)s1 |
| InChI | InChI=1S/C16H13BrN2O3S2/c1-9(2)22-16(21)12-5-6-23-15(12)19-14(20)10(8-18)7-11-3-4-13(17)24-11/h3-7,9H,1-2H3,(H,19,20)/b10-7+ |
| InChIKey | ROKCNLGALQSEOD-JXMROGBWSA-N |
| XLogP | 4.68 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.33 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|