C27H23F3N2O5S — CID 17280832
propan-2-yl 2-[[(E)-2-cyano-3-[4-methoxy-3-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]prop-2-enoyl]amino]thiophene-3-carboxylate (PubChem CID 17280832) has the molecular formula C27H23F3N2O5S and a molecular weight of 544.55 g/mol. Its IUPAC name is propan-2-yl 2-[[(E)-2-cyano-3-[4-methoxy-3-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]prop-2-enoyl]amino]thiophene-3-carboxylate.
| Compound Name | propan-2-yl 2-[[(E)-2-cyano-3-[4-methoxy-3-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]prop-2-enoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17280832 |
| Molecular Formula | C27H23F3N2O5S |
| Molecular Weight | 544.55 g/mol |
| Exact Mass | 544.13 |
| IUPAC Name | propan-2-yl 2-[[(E)-2-cyano-3-[4-methoxy-3-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]prop-2-enoyl]amino]thiophene-3-carboxylate |
| SMILES | COc1ccc(/C=C(\C#N)C(=O)Nc2sccc2C(=O)OC(C)C)cc1COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H23F3N2O5S/c1-16(2)37-26(34)22-9-10-38-25(22)32-24(33)18(14-31)11-17-7-8-23(35-3)19(12-17)15-36-21-6-4-5-20(13-21)27(28,29)30/h4-13,16H,15H2,1-3H3,(H,32,33)/b18-11+ |
| InChIKey | SCEWJGMSIMXOJK-WOJGMQOQSA-N |
| XLogP | 6.47 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.55 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|