C14H11N4NaO — CID 172689902
sodium 1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-2,4,6,9,12,15-hexaene-6-carbonylazanide (PubChem CID 172689902) has the molecular formula C14H11N4NaO and a molecular weight of 274.26 g/mol. Its IUPAC name is sodium 1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-2,4,6,9,12,15-hexaene-6-carbonylazanide.
| Compound Name | sodium 1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-2,4,6,9,12,15-hexaene-6-carbonylazanide |
|---|---|
| PubChem CID | 172689902 |
| Molecular Formula | C14H11N4NaO |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | sodium 1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-2,4,6,9,12,15-hexaene-6-carbonylazanide |
| SMILES | [NH-]C(=O)C1=CN2C=C3N(C=C2C=C1)C=C1CC=CN13.[Na+] |
| InChI | InChI=1S/C14H12N4O.Na/c15-14(19)10-3-4-11-7-17-8-12-2-1-5-18(12)13(17)9-16(11)6-10;/h1,3-9H,2H2,(H2,15,19);/q;+1/p-1 |
| InChIKey | BNRCVZQEKSZFJA-UHFFFAOYSA-M |
| XLogP | -0.64 |
| TPSA | 50.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |