C11H21N3O — CID 172698253
5,5-dimethyl-1-piperidin-1-yl-1,3-diazinan-2-one (PubChem CID 172698253) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 5,5-dimethyl-1-piperidin-1-yl-1,3-diazinan-2-one.
| Compound Name | 5,5-dimethyl-1-piperidin-1-yl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 172698253 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 5,5-dimethyl-1-piperidin-1-yl-1,3-diazinan-2-one |
| SMILES | CC1(C)CNC(=O)N(N2CCCCC2)C1 |
| InChI | InChI=1S/C11H21N3O/c1-11(2)8-12-10(15)14(9-11)13-6-4-3-5-7-13/h3-9H2,1-2H3,(H,12,15) |
| InChIKey | CPPFAKJUIYUASD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |