C19H40NO7P — CID 172699305
(3-amino-2-hydroxy-3-oxopropyl)phosphonic acid;14-methylpentadecanoic acid (PubChem CID 172699305) has the molecular formula C19H40NO7P and a molecular weight of 425.50 g/mol. Its IUPAC name is (3-amino-2-hydroxy-3-oxopropyl)phosphonic acid;14-methylpentadecanoic acid.
| Compound Name | (3-amino-2-hydroxy-3-oxopropyl)phosphonic acid;14-methylpentadecanoic acid |
|---|---|
| PubChem CID | 172699305 |
| Molecular Formula | C19H40NO7P |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | (3-amino-2-hydroxy-3-oxopropyl)phosphonic acid;14-methylpentadecanoic acid |
| SMILES | CC(C)CCCCCCCCCCCCC(=O)O.NC(=O)C(O)CP(=O)(O)O |
| InChI | InChI=1S/C16H32O2.C3H8NO5P/c1-15(2)13-11-9-7-5-3-4-6-8-10-12-14-16(17)18;4-3(6)2(5)1-10(7,8)9/h15H,3-14H2,1-2H3,(H,17,18);2,5H,1H2,(H2,4,6)(H2,7,8,9) |
| InChIKey | CTASJLHPHUNSPP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|