C6H7N3O4S — CID 172707658
pyrazolo[1,5-a]pyrimidine;sulfuric acid (PubChem CID 172707658) has the molecular formula C6H7N3O4S and a molecular weight of 217.21 g/mol. Its IUPAC name is pyrazolo[1,5-a]pyrimidine;sulfuric acid.
| Compound Name | pyrazolo[1,5-a]pyrimidine;sulfuric acid |
|---|---|
| PubChem CID | 172707658 |
| Molecular Formula | C6H7N3O4S |
| Molecular Weight | 217.21 g/mol |
| Exact Mass | 217.02 |
| IUPAC Name | pyrazolo[1,5-a]pyrimidine;sulfuric acid |
| SMILES | O=S(=O)(O)O.c1cnc2ccnn2c1 |
| InChI | InChI=1S/C6H5N3.H2O4S/c1-3-7-6-2-4-8-9(6)5-1;1-5(2,3)4/h1-5H;(H2,1,2,3,4) |
| InChIKey | DUSSOYOWBYIJDH-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.21 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|