C26H22N4O2S — CID 172711038
3-[3-[2-anthracen-9-yl-1-(2-methoxyethoxy)ethenyl]sulfanyl-1H-1,2,4-triazol-5-yl]pyridine (PubChem CID 172711038) has the molecular formula C26H22N4O2S and a molecular weight of 454.56 g/mol. Its IUPAC name is 3-[3-[2-anthracen-9-yl-1-(2-methoxyethoxy)ethenyl]sulfanyl-1H-1,2,4-triazol-5-yl]pyridine.
| Compound Name | 3-[3-[2-anthracen-9-yl-1-(2-methoxyethoxy)ethenyl]sulfanyl-1H-1,2,4-triazol-5-yl]pyridine |
|---|---|
| PubChem CID | 172711038 |
| Molecular Formula | C26H22N4O2S |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 3-[3-[2-anthracen-9-yl-1-(2-methoxyethoxy)ethenyl]sulfanyl-1H-1,2,4-triazol-5-yl]pyridine |
| SMILES | COCCOC(=Cc1c2ccccc2cc2ccccc12)Sc1n[nH]c(-c2cccnc2)n1 |
| InChI | InChI=1S/C26H22N4O2S/c1-31-13-14-32-24(33-26-28-25(29-30-26)20-9-6-12-27-17-20)16-23-21-10-4-2-7-18(21)15-19-8-3-5-11-22(19)23/h2-12,15-17H,13-14H2,1H3,(H,28,29,30) |
| InChIKey | FGDRYGSJZRPBBP-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|