C15H12N4O2S2 — CID 66560886
methyl 2-[(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)disulfanyl]benzoate (PubChem CID 66560886) has the molecular formula C15H12N4O2S2 and a molecular weight of 344.42 g/mol. Its IUPAC name is methyl 2-[(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)disulfanyl]benzoate.
| Compound Name | methyl 2-[(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)disulfanyl]benzoate |
|---|---|
| PubChem CID | 66560886 |
| Molecular Formula | C15H12N4O2S2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | methyl 2-[(5-pyridin-3-yl-1H-1,2,4-triazol-3-yl)disulfanyl]benzoate |
| SMILES | COC(=O)c1ccccc1SSc1n[nH]c(-c2cccnc2)n1 |
| InChI | InChI=1S/C15H12N4O2S2/c1-21-14(20)11-6-2-3-7-12(11)22-23-15-17-13(18-19-15)10-5-4-8-16-9-10/h2-9H,1H3,(H,17,18,19) |
| InChIKey | ACFKPKLWNGKLRZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|