C24H30N2O2S — CID 172721457
4-(2-bicyclo[2.2.1]heptanylmethyl)-2-[3-(3-methoxyphenyl)propylsulfanyl]pyridine-3-carboxamide (PubChem CID 172721457) has the molecular formula C24H30N2O2S and a molecular weight of 410.58 g/mol. Its IUPAC name is 4-(2-bicyclo[2.2.1]heptanylmethyl)-2-[3-(3-methoxyphenyl)propylsulfanyl]pyridine-3-carboxamide.
| Compound Name | 4-(2-bicyclo[2.2.1]heptanylmethyl)-2-[3-(3-methoxyphenyl)propylsulfanyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 172721457 |
| Molecular Formula | C24H30N2O2S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 4-(2-bicyclo[2.2.1]heptanylmethyl)-2-[3-(3-methoxyphenyl)propylsulfanyl]pyridine-3-carboxamide |
| SMILES | COc1cccc(CCCSc2nccc(CC3CC4CCC3C4)c2C(N)=O)c1 |
| InChI | InChI=1S/C24H30N2O2S/c1-28-21-6-2-4-16(14-21)5-3-11-29-24-22(23(25)27)19(9-10-26-24)15-20-13-17-7-8-18(20)12-17/h2,4,6,9-10,14,17-18,20H,3,5,7-8,11-13,15H2,1H3,(H2,25,27) |
| InChIKey | GOLHNDLCSDZWFU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|