C16H12N2O2 — CID 172740674
(2-imidazo[1,2-a]pyridin-2-ylphenyl) prop-2-enoate (PubChem CID 172740674) has the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. Its IUPAC name is (2-imidazo[1,2-a]pyridin-2-ylphenyl) prop-2-enoate.
| Compound Name | (2-imidazo[1,2-a]pyridin-2-ylphenyl) prop-2-enoate |
|---|---|
| PubChem CID | 172740674 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | (2-imidazo[1,2-a]pyridin-2-ylphenyl) prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccccc1-c1cn2ccccc2n1 |
| InChI | InChI=1S/C16H12N2O2/c1-2-16(19)20-14-8-4-3-7-12(14)13-11-18-10-6-5-9-15(18)17-13/h2-11H,1H2 |
| InChIKey | JBBCCVWQEFKZGE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|