C14H10N2O3 — CID 135030601
(2-imidazo[1,2-a]pyridin-2-ylphenyl) hydrogen carbonate (PubChem CID 135030601) has the molecular formula C14H10N2O3 and a molecular weight of 254.25 g/mol. Its IUPAC name is (2-imidazo[1,2-a]pyridin-2-ylphenyl) hydrogen carbonate.
| Compound Name | (2-imidazo[1,2-a]pyridin-2-ylphenyl) hydrogen carbonate |
|---|---|
| PubChem CID | 135030601 |
| Molecular Formula | C14H10N2O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | (2-imidazo[1,2-a]pyridin-2-ylphenyl) hydrogen carbonate |
| SMILES | O=C(O)Oc1ccccc1-c1cn2ccccc2n1 |
| InChI | InChI=1S/C14H10N2O3/c17-14(18)19-12-6-2-1-5-10(12)11-9-16-8-4-3-7-13(16)15-11/h1-9H,(H,17,18) |
| InChIKey | KXMBSTQZPIPEQE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|