About bis((4-butylcyclopenta-1,4-dien-1-yl)-trimethylsilane);dimethylsilylidenetitanium(2+)
bis((4-butylcyclopenta-1,4-dien-1-yl)-trimethylsilane);dimethylsilylidenetitanium(2+) (PubChem CID 172744243) has the molecular formula C26H48Si3Ti
and a molecular weight of 492.80 g/mol. Its IUPAC name is bis((4-butylcyclopenta-1,4-dien-1-yl)-trimethylsilane);dimethylsilylidenetitanium(2+).
Molecular Properties
| Compound Name | bis((4-butylcyclopenta-1,4-dien-1-yl)-trimethylsilane);dimethylsilylidenetitanium(2+) |
| PubChem CID | 172744243 |
| Molecular Formula | C26H48Si3Ti |
| Molecular Weight | 492.80 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | bis((4-butylcyclopenta-1,4-dien-1-yl)-trimethylsilane);dimethylsilylidenetitanium(2+) |
| SMILES | CCCCC1=CC([Si](C)(C)C)=[C-]C1.CCCCC1=CC([Si](C)(C)C)=[C-]C1.C[Si](C)=[Ti+2] |
| InChI | InChI=1S/2C12H21Si.C2H6Si.Ti/c2*1-5-6-7-11-8-9-12(10-11)13(2,3)4;1-3-2;/h2*10H,5-8H2,1-4H3;1-2H3;/q2*-1;;+2 |
| InChIKey | DPCAWLTUXFHGSG-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.80 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis((4-butylcyclopenta-1,4-dien-1-yl)-trimethylsilane);dimethylsilylidenetitanium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((4-butylcyclopenta-1,4-dien-1-yl)-trimethylsilane);dimethylsilylidenetitanium(2+)?
The IUPAC name of bis((4-butylcyclopenta-1,4-dien-1-yl)-trimethylsilane);dimethylsilylidenetitanium(2+) (CID 172744243) is bis((4-butylcyclopenta-1,4-dien-1-yl)-trimethylsilane);dimethylsilylidenetitanium(2+).
What is the SMILES notation for bis((4-butylcyclopenta-1,4-dien-1-yl)-trimethylsilane);dimethylsilylidenetitanium(2+)?
The canonical SMILES for bis((4-butylcyclopenta-1,4-dien-1-yl)-trimethylsilane);dimethylsilylidenetitanium(2+) is CCCCC1=CC([Si](C)(C)C)=[C-]C1.CCCCC1=CC([Si](C)(C)C)=[C-]C1.C[Si](C)=[Ti+2].
What is the InChIKey of bis((4-butylcyclopenta-1,4-dien-1-yl)-trimethylsilane);dimethylsilylidenetitanium(2+)?
The InChIKey is DPCAWLTUXFHGSG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H21Si.C2H6Si.Ti/c2*1-5-6-7-11-8-9-12(10-11)13(2,3)4;1-3-2;/h2*10H,5-8H2,1-4H3;1-2H3;/q2*-1;;+2.
What are the key properties of bis((4-butylcyclopenta-1,4-dien-1-yl)-trimethylsilane);dimethylsilylidenetitanium(2+)?
bis((4-butylcyclopenta-1,4-dien-1-yl)-trimethylsilane);dimethylsilylidenetitanium(2+) has a molecular weight of 492.80 g/mol, XLogP of 9.01, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis((4-butylcyclopenta-1,4-dien-1-yl)-trimethylsilane);dimethylsilylidenetitanium(2+) is sourced from PubChem (CID 172744243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).