C7H12N4NaOS — CID 172749453
CID 172749453 (PubChem CID 172749453) has the molecular formula C7H12N4NaOS and a molecular weight of 223.26 g/mol.
| Compound Name | CID 172749453 |
|---|---|
| PubChem CID | 172749453 |
| Molecular Formula | C7H12N4NaOS |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | — |
| SMILES | COc1nsc(N2CCNCC2)n1.[Na] |
| InChI | InChI=1S/C7H12N4OS.Na/c1-12-6-9-7(13-10-6)11-4-2-8-3-5-11;/h8H,2-5H2,1H3; |
| InChIKey | KEBWAUXOJQAGHV-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |