C13H17N5O — CID 59511192
1-(5-methoxy-2-phenyl-1,2,4-triazol-3-yl)piperazine (PubChem CID 59511192) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 1-(5-methoxy-2-phenyl-1,2,4-triazol-3-yl)piperazine.
| Compound Name | 1-(5-methoxy-2-phenyl-1,2,4-triazol-3-yl)piperazine |
|---|---|
| PubChem CID | 59511192 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 1-(5-methoxy-2-phenyl-1,2,4-triazol-3-yl)piperazine |
| SMILES | COc1nc(N2CCNCC2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C13H17N5O/c1-19-12-15-13(17-9-7-14-8-10-17)18(16-12)11-5-3-2-4-6-11/h2-6,14H,7-10H2,1H3 |
| InChIKey | PDOCTTGOMNABKP-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |