C18H19ClN2O2 — CID 172759462
1-[2-[(2-chlorophenyl)methyl-prop-2-ynylamino]ethyl]-3-hydroxy-2-methylpyridin-4-one (PubChem CID 172759462) has the molecular formula C18H19ClN2O2 and a molecular weight of 330.82 g/mol. Its IUPAC name is 1-[2-[(2-chlorophenyl)methyl-prop-2-ynylamino]ethyl]-3-hydroxy-2-methylpyridin-4-one.
| Compound Name | 1-[2-[(2-chlorophenyl)methyl-prop-2-ynylamino]ethyl]-3-hydroxy-2-methylpyridin-4-one |
|---|---|
| PubChem CID | 172759462 |
| Molecular Formula | C18H19ClN2O2 |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 1-[2-[(2-chlorophenyl)methyl-prop-2-ynylamino]ethyl]-3-hydroxy-2-methylpyridin-4-one |
| SMILES | C#CCN(CCn1ccc(=O)c(O)c1C)Cc1ccccc1Cl |
| InChI | InChI=1S/C18H19ClN2O2/c1-3-9-20(13-15-6-4-5-7-16(15)19)11-12-21-10-8-17(22)18(23)14(21)2/h1,4-8,10,23H,9,11-13H2,2H3 |
| InChIKey | LMEWMARCXHLACJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|