C14H22Br2F4N4 — CID 172762379
1-butyl-3-methylimidazol-3-ium;1-methyl-3-(1,2,2,2-tetrafluoroethyl)imidazol-1-ium;dibromide (PubChem CID 172762379) has the molecular formula C14H22Br2F4N4 and a molecular weight of 482.16 g/mol. Its IUPAC name is 1-butyl-3-methylimidazol-3-ium;1-methyl-3-(1,2,2,2-tetrafluoroethyl)imidazol-1-ium;dibromide.
| Compound Name | 1-butyl-3-methylimidazol-3-ium;1-methyl-3-(1,2,2,2-tetrafluoroethyl)imidazol-1-ium;dibromide |
|---|---|
| PubChem CID | 172762379 |
| Molecular Formula | C14H22Br2F4N4 |
| Molecular Weight | 482.16 g/mol |
| Exact Mass | 480.01 |
| IUPAC Name | 1-butyl-3-methylimidazol-3-ium;1-methyl-3-(1,2,2,2-tetrafluoroethyl)imidazol-1-ium;dibromide |
| SMILES | CCCCn1cc[n+](C)c1.C[n+]1ccn(C(F)C(F)(F)F)c1.[Br-].[Br-] |
| InChI | InChI=1S/C8H15N2.C6H7F4N2.2BrH/c1-3-4-5-10-7-6-9(2)8-10;1-11-2-3-12(4-11)5(7)6(8,9)10;;/h6-8H,3-5H2,1-2H3;2-5H,1H3;2*1H/q2*+1;;/p-2 |
| InChIKey | LVZUNWMYUYVGAK-UHFFFAOYSA-L |
| XLogP | -3.54 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.16 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|