C30H38O2P+ — CID 172766229
[2,3-bis(2-methyl-3-pentylphenyl)phenyl]-hydroxy-oxophosphanium (PubChem CID 172766229) has the molecular formula C30H38O2P+ and a molecular weight of 461.61 g/mol. Its IUPAC name is [2,3-bis(2-methyl-3-pentylphenyl)phenyl]-hydroxy-oxophosphanium.
| Compound Name | [2,3-bis(2-methyl-3-pentylphenyl)phenyl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 172766229 |
| Molecular Formula | C30H38O2P+ |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | [2,3-bis(2-methyl-3-pentylphenyl)phenyl]-hydroxy-oxophosphanium |
| SMILES | CCCCCc1cccc(-c2cccc([P+](=O)O)c2-c2cccc(CCCCC)c2C)c1C |
| InChI | InChI=1S/C30H37O2P/c1-5-7-9-14-24-16-11-18-26(22(24)3)28-20-13-21-29(33(31)32)30(28)27-19-12-17-25(23(27)4)15-10-8-6-2/h11-13,16-21H,5-10,14-15H2,1-4H3/p+1 |
| InChIKey | QPVKEWVTZPSDEK-UHFFFAOYSA-O |
| XLogP | 8.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|