C16H24O — CID 159745539
2-methyl-3-octylcyclohepta-2,4,6-trien-1-one (PubChem CID 159745539) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is 2-methyl-3-octylcyclohepta-2,4,6-trien-1-one.
| Compound Name | 2-methyl-3-octylcyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 159745539 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 2-methyl-3-octylcyclohepta-2,4,6-trien-1-one |
| SMILES | CCCCCCCCc1ccccc(=O)c1C |
| InChI | InChI=1S/C16H24O/c1-3-4-5-6-7-8-11-15-12-9-10-13-16(17)14(15)2/h9-10,12-13H,3-8,11H2,1-2H3 |
| InChIKey | ROMUHYHFSFIISL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|